C16H19ClFNO3 — CID 122066882
3-[[1-(3-chloro-2-fluorophenyl)cyclopentyl]methylamino]-2-methyl-3-oxopropanoic acid (PubChem CID 122066882) has the molecular formula C16H19ClFNO3 and a molecular weight of 327.78 g/mol. Its IUPAC name is 3-[[1-(3-chloro-2-fluorophenyl)cyclopentyl]methylamino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[[1-(3-chloro-2-fluorophenyl)cyclopentyl]methylamino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 122066882 |
| Molecular Formula | C16H19ClFNO3 |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3-[[1-(3-chloro-2-fluorophenyl)cyclopentyl]methylamino]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)NCC1(c2cccc(Cl)c2F)CCCC1 |
| InChI | InChI=1S/C16H19ClFNO3/c1-10(15(21)22)14(20)19-9-16(7-2-3-8-16)11-5-4-6-12(17)13(11)18/h4-6,10H,2-3,7-9H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | XVOBBICXTSMKFT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|