C8H6N2O2S — CID 140775055
2-thiophen-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 140775055) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is 2-thiophen-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-thiophen-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 140775055 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 2-thiophen-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C8H6N2O2S/c9-7(11)5-4-12-8(10-5)6-2-1-3-13-6/h1-4H,(H2,9,11) |
| InChIKey | ALFXMDBMAFIQBV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |