C8H7NO2S — CID 174374567
4-methoxy-2-thiophen-2-yl-1,3-oxazole (PubChem CID 174374567) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 4-methoxy-2-thiophen-2-yl-1,3-oxazole.
| Compound Name | 4-methoxy-2-thiophen-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 174374567 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 4-methoxy-2-thiophen-2-yl-1,3-oxazole |
| SMILES | COc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C8H7NO2S/c1-10-7-5-11-8(9-7)6-3-2-4-12-6/h2-5H,1H3 |
| InChIKey | LVNBEFPHWMKQLT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |