C10H12N2OS — CID 115083577
2-(2-thiophen-2-yl-1,3-oxazol-4-yl)propan-1-amine (PubChem CID 115083577) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 2-(2-thiophen-2-yl-1,3-oxazol-4-yl)propan-1-amine.
| Compound Name | 2-(2-thiophen-2-yl-1,3-oxazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 115083577 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-(2-thiophen-2-yl-1,3-oxazol-4-yl)propan-1-amine |
| SMILES | CC(CN)c1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C10H12N2OS/c1-7(5-11)8-6-13-10(12-8)9-3-2-4-14-9/h2-4,6-7H,5,11H2,1H3 |
| InChIKey | MYCQRNMQMXHOMB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |