C10H11ClN2OS — CID 115083581
2-[2-(5-chlorothiophen-2-yl)-1,3-oxazol-4-yl]propan-1-amine (PubChem CID 115083581) has the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-1,3-oxazol-4-yl]propan-1-amine.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-1,3-oxazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 115083581 |
| Molecular Formula | C10H11ClN2OS |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-1,3-oxazol-4-yl]propan-1-amine |
| SMILES | CC(CN)c1coc(-c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C10H11ClN2OS/c1-6(4-12)7-5-14-10(13-7)8-2-3-9(11)15-8/h2-3,5-6H,4,12H2,1H3 |
| InChIKey | CQFJKOWWHLYPEN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |