C13H16N2O — CID 115084536
2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]propan-1-amine (PubChem CID 115084536) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]propan-1-amine.
| Compound Name | 2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 115084536 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]propan-1-amine |
| SMILES | Cc1ccc(-c2nc(C(C)CN)co2)cc1 |
| InChI | InChI=1S/C13H16N2O/c1-9-3-5-11(6-4-9)13-15-12(8-16-13)10(2)7-14/h3-6,8,10H,7,14H2,1-2H3 |
| InChIKey | QEVBMHCYMOHABE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |