C11H11FN2O2 — CID 67322495
2-amino-1-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethanol (PubChem CID 67322495) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 2-amino-1-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethanol.
| Compound Name | 2-amino-1-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethanol |
|---|---|
| PubChem CID | 67322495 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-amino-1-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethanol |
| SMILES | NCC(O)c1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C11H11FN2O2/c12-8-3-1-7(2-4-8)11-14-9(6-16-11)10(15)5-13/h1-4,6,10,15H,5,13H2 |
| InChIKey | SHRCPUJCKSQWHV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |