C12H11NO3 — CID 571056
ethyl 2-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 571056) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is ethyl 2-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 571056 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | ethyl 2-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H11NO3/c1-2-15-12(14)10-8-16-11(13-10)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | OMURDPWNJICYDW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |