C12H12FNO — CID 146379712
2-(4-fluorophenyl)-4-propan-2-yl-1,3-oxazole (PubChem CID 146379712) has the molecular formula C12H12FNO and a molecular weight of 205.23 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-propan-2-yl-1,3-oxazole.
| Compound Name | 2-(4-fluorophenyl)-4-propan-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 146379712 |
| Molecular Formula | C12H12FNO |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-(4-fluorophenyl)-4-propan-2-yl-1,3-oxazole |
| SMILES | CC(C)c1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H12FNO/c1-8(2)11-7-15-12(14-11)9-3-5-10(13)6-4-9/h3-8H,1-2H3 |
| InChIKey | REIFWCLDXZRHSK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |