C13H11FN2O — CID 123356610
2-(4-fluorophenyl)-4-(2-isocyanopropan-2-yl)-1,3-oxazole (PubChem CID 123356610) has the molecular formula C13H11FN2O and a molecular weight of 230.24 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-(2-isocyanopropan-2-yl)-1,3-oxazole.
| Compound Name | 2-(4-fluorophenyl)-4-(2-isocyanopropan-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 123356610 |
| Molecular Formula | C13H11FN2O |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-(4-fluorophenyl)-4-(2-isocyanopropan-2-yl)-1,3-oxazole |
| SMILES | [C-]#[N+]C(C)(C)c1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C13H11FN2O/c1-13(2,15-3)11-8-17-12(16-11)9-4-6-10(14)7-5-9/h4-8H,1-2H3 |
| InChIKey | MPLXHHXKUMMETD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 30.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|