C10H7FN4O — CID 61373650
4-(azidomethyl)-2-(4-fluorophenyl)-1,3-oxazole (PubChem CID 61373650) has the molecular formula C10H7FN4O and a molecular weight of 218.19 g/mol. Its IUPAC name is 4-(azidomethyl)-2-(4-fluorophenyl)-1,3-oxazole.
| Compound Name | 4-(azidomethyl)-2-(4-fluorophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 61373650 |
| Molecular Formula | C10H7FN4O |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 4-(azidomethyl)-2-(4-fluorophenyl)-1,3-oxazole |
| SMILES | [N-]=[N+]=NCc1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C10H7FN4O/c11-8-3-1-7(2-4-8)10-14-9(6-16-10)5-13-15-12/h1-4,6H,5H2 |
| InChIKey | ADEDSQIRIHEREV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|