C14H16FNOS — CID 78845847
4-(butylsulfanylmethyl)-2-(4-fluorophenyl)-1,3-oxazole (PubChem CID 78845847) has the molecular formula C14H16FNOS and a molecular weight of 265.35 g/mol. Its IUPAC name is 4-(butylsulfanylmethyl)-2-(4-fluorophenyl)-1,3-oxazole.
| Compound Name | 4-(butylsulfanylmethyl)-2-(4-fluorophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 78845847 |
| Molecular Formula | C14H16FNOS |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-(butylsulfanylmethyl)-2-(4-fluorophenyl)-1,3-oxazole |
| SMILES | CCCCSCc1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H16FNOS/c1-2-3-8-18-10-13-9-17-14(16-13)11-4-6-12(15)7-5-11/h4-7,9H,2-3,8,10H2,1H3 |
| InChIKey | NUCGNKHFXCMUOD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|