C15H19FN2O — CID 56682845
N-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]pentan-2-amine (PubChem CID 56682845) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]pentan-2-amine.
| Compound Name | N-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]pentan-2-amine |
|---|---|
| PubChem CID | 56682845 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]pentan-2-amine |
| SMILES | CCCC(C)NCc1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H19FN2O/c1-3-4-11(2)17-9-14-10-19-15(18-14)12-5-7-13(16)8-6-12/h5-8,10-11,17H,3-4,9H2,1-2H3 |
| InChIKey | YZBAKUSCUWYQIF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |