C24H30N2O3 — CID 56683848
N-[[2-[4-(4-methoxyphenoxy)phenyl]-1,3-oxazol-4-yl]methyl]heptan-2-amine (PubChem CID 56683848) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[[2-[4-(4-methoxyphenoxy)phenyl]-1,3-oxazol-4-yl]methyl]heptan-2-amine.
| Compound Name | N-[[2-[4-(4-methoxyphenoxy)phenyl]-1,3-oxazol-4-yl]methyl]heptan-2-amine |
|---|---|
| PubChem CID | 56683848 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-[[2-[4-(4-methoxyphenoxy)phenyl]-1,3-oxazol-4-yl]methyl]heptan-2-amine |
| SMILES | CCCCCC(C)NCc1coc(-c2ccc(Oc3ccc(OC)cc3)cc2)n1 |
| InChI | InChI=1S/C24H30N2O3/c1-4-5-6-7-18(2)25-16-20-17-28-24(26-20)19-8-10-22(11-9-19)29-23-14-12-21(27-3)13-15-23/h8-15,17-18,25H,4-7,16H2,1-3H3 |
| InChIKey | SITIXROZVJKRMR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|