C17H23ClN2O — CID 46220080
N-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine (PubChem CID 46220080) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is N-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine.
| Compound Name | N-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine |
|---|---|
| PubChem CID | 46220080 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine |
| SMILES | CCCCCC(C)NCc1coc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H23ClN2O/c1-3-4-5-6-13(2)19-11-16-12-21-17(20-16)14-7-9-15(18)10-8-14/h7-10,12-13,19H,3-6,11H2,1-2H3 |
| InChIKey | LOJMUTSAGSEHIX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|