C19H27FN4O — CID 110978729
1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-(3-methylbutyl)guanidine (PubChem CID 110978729) has the molecular formula C19H27FN4O and a molecular weight of 346.45 g/mol. Its IUPAC name is 1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-(3-methylbutyl)guanidine.
| Compound Name | 1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-(3-methylbutyl)guanidine |
|---|---|
| PubChem CID | 110978729 |
| Molecular Formula | C19H27FN4O |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-(3-methylbutyl)guanidine |
| SMILES | CCN/C(=N\CCC(C)C)NCCc1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H27FN4O/c1-4-21-19(22-11-9-14(2)3)23-12-10-17-13-25-18(24-17)15-5-7-16(20)8-6-15/h5-8,13-14H,4,9-12H2,1-3H3,(H2,21,22,23) |
| InChIKey | BBPUVMSMJPMXGW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|