C18H26FIN4O — CID 111180414
1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-(2-methylpropyl)guanidine;hydroiodide (PubChem CID 111180414) has the molecular formula C18H26FIN4O and a molecular weight of 460.34 g/mol. Its IUPAC name is 1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-(2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-(2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111180414 |
| Molecular Formula | C18H26FIN4O |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-(2-methylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)C)NCCc1coc(-c2ccc(F)cc2)n1.I |
| InChI | InChI=1S/C18H25FN4O.HI/c1-4-20-18(22-11-13(2)3)21-10-9-16-12-24-17(23-16)14-5-7-15(19)8-6-14;/h5-8,12-13H,4,9-11H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | VHUZXFWIIHIELN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|