C21H26FIN4OS — CID 111704850
1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111704850) has the molecular formula C21H26FIN4OS and a molecular weight of 528.44 g/mol. Its IUPAC name is 1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111704850 |
| Molecular Formula | C21H26FIN4OS |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | 1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1ccsc1)NCCc1coc(-c2ccc(F)cc2)n1.I |
| InChI | InChI=1S/C21H25FN4OS.HI/c1-3-23-21(25-12-15(2)17-9-11-28-14-17)24-10-8-19-13-27-20(26-19)16-4-6-18(22)7-5-16;/h4-7,9,11,13-15H,3,8,10,12H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | OMJNSAHYWFETMU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|