C21H27IN4OS — CID 111702739
2-methyl-1-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111702739) has the molecular formula C21H27IN4OS and a molecular weight of 510.45 g/mol. Its IUPAC name is 2-methyl-1-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111702739 |
| Molecular Formula | C21H27IN4OS |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 2-methyl-1-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1coc(-c2ccc(C)cc2)n1)NCC(C)c1ccsc1.I |
| InChI | InChI=1S/C21H26N4OS.HI/c1-15-4-6-17(7-5-15)20-25-19(13-26-20)8-10-23-21(22-3)24-12-16(2)18-9-11-27-14-18;/h4-7,9,11,13-14,16H,8,10,12H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | LVGWAPDZPHGNJB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|