C20H28FN5O2 — CID 111385862
N-tert-butyl-2-[[ethylamino-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethylamino]methylidene]amino]acetamide (PubChem CID 111385862) has the molecular formula C20H28FN5O2 and a molecular weight of 389.48 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethylamino]methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[ethylamino-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111385862 |
| Molecular Formula | C20H28FN5O2 |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethylamino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCCc1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H28FN5O2/c1-5-22-19(24-12-17(27)26-20(2,3)4)23-11-10-16-13-28-18(25-16)14-6-8-15(21)9-7-14/h6-9,13H,5,10-12H2,1-4H3,(H,26,27)(H2,22,23,24) |
| InChIKey | NQINGKHBGSBUMB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|