C21H31FIN5O2 — CID 111942342
N,N-diethyl-3-[[ethylamino-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethylamino]methylidene]amino]propanamide;hydroiodide (PubChem CID 111942342) has the molecular formula C21H31FIN5O2 and a molecular weight of 531.41 g/mol. Its IUPAC name is N,N-diethyl-3-[[ethylamino-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethylamino]methylidene]amino]propanamide;hydroiodide.
| Compound Name | N,N-diethyl-3-[[ethylamino-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethylamino]methylidene]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111942342 |
| Molecular Formula | C21H31FIN5O2 |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | N,N-diethyl-3-[[ethylamino-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethylamino]methylidene]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)N(CC)CC)NCCc1coc(-c2ccc(F)cc2)n1.I |
| InChI | InChI=1S/C21H30FN5O2.HI/c1-4-23-21(25-14-12-19(28)27(5-2)6-3)24-13-11-18-15-29-20(26-18)16-7-9-17(22)10-8-16;/h7-10,15H,4-6,11-14H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | UMUGYTSRWCXTNR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|