C18H24F3IN4O — CID 109471826
1-ethyl-3-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109471826) has the molecular formula C18H24F3IN4O and a molecular weight of 496.32 g/mol. Its IUPAC name is 1-ethyl-3-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109471826 |
| Molecular Formula | C18H24F3IN4O |
| Molecular Weight | 496.32 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 1-ethyl-3-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCc1coc(-c2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C18H23F3N4O.HI/c1-3-22-17(24-11-9-18(19,20)21)23-10-8-15-12-26-16(25-15)14-6-4-13(2)5-7-14;/h4-7,12H,3,8-11H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | PHVDEEZWIYKACW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|