C23H28N4O — CID 111135853
1-ethyl-2-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-(2-phenylethyl)guanidine (PubChem CID 111135853) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-ethyl-2-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-(2-phenylethyl)guanidine.
| Compound Name | 1-ethyl-2-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111135853 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 1-ethyl-2-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-(2-phenylethyl)guanidine |
| SMILES | CCN/C(=N\CCc1coc(-c2ccc(C)cc2)n1)NCCc1ccccc1 |
| InChI | InChI=1S/C23H28N4O/c1-3-24-23(25-15-13-19-7-5-4-6-8-19)26-16-14-21-17-28-22(27-21)20-11-9-18(2)10-12-20/h4-12,17H,3,13-16H2,1-2H3,(H2,24,25,26) |
| InChIKey | KKRXRZRMBJIVOA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|