C22H28IN5O3S — CID 111591878
1-ethyl-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111591878) has the molecular formula C22H28IN5O3S and a molecular weight of 569.47 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111591878 |
| Molecular Formula | C22H28IN5O3S |
| Molecular Weight | 569.47 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | 1-ethyl-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccc(C)cc2)n1)NCCc1ccc(S(N)(=O)=O)cc1.I |
| InChI | InChI=1S/C22H27N5O3S.HI/c1-3-24-22(25-13-12-17-6-10-20(11-7-17)31(23,28)29)26-14-19-15-30-21(27-19)18-8-4-16(2)5-9-18;/h4-11,15H,3,12-14H2,1-2H3,(H2,23,28,29)(H2,24,25,26);1H |
| InChIKey | RUUMEBPJYSTCOJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|