C20H30FIN6O — CID 111518750
N-tert-butyl-2-[[ethylamino-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111518750) has the molecular formula C20H30FIN6O and a molecular weight of 516.40 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[ethylamino-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111518750 |
| Molecular Formula | C20H30FIN6O |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCCc1ccn(-c2ccc(F)cc2)n1.I |
| InChI | InChI=1S/C20H29FN6O.HI/c1-5-22-19(24-14-18(28)25-20(2,3)4)23-12-10-16-11-13-27(26-16)17-8-6-15(21)7-9-17;/h6-9,11,13H,5,10,12,14H2,1-4H3,(H,25,28)(H2,22,23,24);1H |
| InChIKey | BTUCDZRIJOYJHN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|