C16H23FIN5 — CID 111512857
1-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-methyl-3-propylguanidine;hydroiodide (PubChem CID 111512857) has the molecular formula C16H23FIN5 and a molecular weight of 431.30 g/mol. Its IUPAC name is 1-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-methyl-3-propylguanidine;hydroiodide.
| Compound Name | 1-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-methyl-3-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111512857 |
| Molecular Formula | C16H23FIN5 |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 1-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-methyl-3-propylguanidine;hydroiodide |
| SMILES | CCCN/C(=N\C)NCCc1ccn(-c2ccc(F)cc2)n1.I |
| InChI | InChI=1S/C16H22FN5.HI/c1-3-10-19-16(18-2)20-11-8-14-9-12-22(21-14)15-6-4-13(17)5-7-15;/h4-7,9,12H,3,8,10-11H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | RQACEKFNWXOHTM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|