C16H22FN5S — CID 111516473
1-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine (PubChem CID 111516473) has the molecular formula C16H22FN5S and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 1-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111516473 |
| Molecular Formula | C16H22FN5S |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine |
| SMILES | C/N=C(\NCCSC)NCCc1ccn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H22FN5S/c1-18-16(20-10-12-23-2)19-9-7-14-8-11-22(21-14)15-5-3-13(17)4-6-15/h3-6,8,11H,7,9-10,12H2,1-2H3,(H2,18,19,20) |
| InChIKey | QEKYAZMTHQXJEX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|