C18H26FIN6OS — CID 110035530
2-[[N'-[[1-(4-fluorophenyl)pyrazol-3-yl]methyl]-N-(2-methylsulfanylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110035530) has the molecular formula C18H26FIN6OS and a molecular weight of 520.42 g/mol. Its IUPAC name is 2-[[N'-[[1-(4-fluorophenyl)pyrazol-3-yl]methyl]-N-(2-methylsulfanylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[[1-(4-fluorophenyl)pyrazol-3-yl]methyl]-N-(2-methylsulfanylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110035530 |
| Molecular Formula | C18H26FIN6OS |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 2-[[N'-[[1-(4-fluorophenyl)pyrazol-3-yl]methyl]-N-(2-methylsulfanylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CSCCN/C(=N\Cc1ccn(-c2ccc(F)cc2)n1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C18H25FN6OS.HI/c1-24(2)17(26)13-22-18(20-9-11-27-3)21-12-15-8-10-25(23-15)16-6-4-14(19)5-7-16;/h4-8,10H,9,11-13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | XYDHZSOEDHNUSA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|