C16H22N6O — CID 119133044
N,N-dimethyl-2-[[N'-methyl-N-[(1-phenylpyrazol-3-yl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 119133044) has the molecular formula C16H22N6O and a molecular weight of 314.39 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N'-methyl-N-[(1-phenylpyrazol-3-yl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N'-methyl-N-[(1-phenylpyrazol-3-yl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 119133044 |
| Molecular Formula | C16H22N6O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | N,N-dimethyl-2-[[N'-methyl-N-[(1-phenylpyrazol-3-yl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)N(C)C)NCc1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H22N6O/c1-17-16(19-12-15(23)21(2)3)18-11-13-9-10-22(20-13)14-7-5-4-6-8-14/h4-10H,11-12H2,1-3H3,(H2,17,18,19) |
| InChIKey | NKDPHPJASNSTDA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|