C22H27N5O3 — CID 111368301
2-methyl-1-[(1-phenylpyrazol-3-yl)methyl]-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111368301) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-methyl-1-[(1-phenylpyrazol-3-yl)methyl]-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(1-phenylpyrazol-3-yl)methyl]-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111368301 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 2-methyl-1-[(1-phenylpyrazol-3-yl)methyl]-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccn(-c2ccccc2)n1)NCc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C22H27N5O3/c1-23-22(24-14-16-12-20(29-3)21(30-4)13-19(16)28-2)25-15-17-10-11-27(26-17)18-8-6-5-7-9-18/h5-13H,14-15H2,1-4H3,(H2,23,24,25) |
| InChIKey | WMPABEKWTOVNPG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|