C17H17F3N6S — CID 111615262
2-methyl-1-[(1-phenylpyrazol-3-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111615262) has the molecular formula C17H17F3N6S and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-methyl-1-[(1-phenylpyrazol-3-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 2-methyl-1-[(1-phenylpyrazol-3-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111615262 |
| Molecular Formula | C17H17F3N6S |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-methyl-1-[(1-phenylpyrazol-3-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccn(-c2ccccc2)n1)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C17H17F3N6S/c1-21-16(23-10-15-24-14(11-27-15)17(18,19)20)22-9-12-7-8-26(25-12)13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H2,21,22,23) |
| InChIKey | KDLIDHQBWSXABW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|