C18H20F3IN6S — CID 111615460
2-methyl-1-[2-(1-phenylpyrazol-4-yl)ethyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111615460) has the molecular formula C18H20F3IN6S and a molecular weight of 536.37 g/mol. Its IUPAC name is 2-methyl-1-[2-(1-phenylpyrazol-4-yl)ethyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(1-phenylpyrazol-4-yl)ethyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111615460 |
| Molecular Formula | C18H20F3IN6S |
| Molecular Weight | 536.37 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | 2-methyl-1-[2-(1-phenylpyrazol-4-yl)ethyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cnn(-c2ccccc2)c1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C18H19F3N6S.HI/c1-22-17(24-10-16-26-15(12-28-16)18(19,20)21)23-8-7-13-9-25-27(11-13)14-5-3-2-4-6-14;/h2-6,9,11-12H,7-8,10H2,1H3,(H2,22,23,24);1H |
| InChIKey | MEEMBFKFAYHUGS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|