C17H30N6O2 — CID 110035987
2-[[N'-[(1-cyclopentylpyrazol-3-yl)methyl]-N-(2-methoxyethyl)carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110035987) has the molecular formula C17H30N6O2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-[[N'-[(1-cyclopentylpyrazol-3-yl)methyl]-N-(2-methoxyethyl)carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[(1-cyclopentylpyrazol-3-yl)methyl]-N-(2-methoxyethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110035987 |
| Molecular Formula | C17H30N6O2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 2-[[N'-[(1-cyclopentylpyrazol-3-yl)methyl]-N-(2-methoxyethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COCCN/C(=N\Cc1ccn(C2CCCC2)n1)NCC(=O)N(C)C |
| InChI | InChI=1S/C17H30N6O2/c1-22(2)16(24)13-20-17(18-9-11-25-3)19-12-14-8-10-23(21-14)15-6-4-5-7-15/h8,10,15H,4-7,9,11-13H2,1-3H3,(H2,18,19,20) |
| InChIKey | NXVDJANVJBHXMZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|