C19H34N6O2 — CID 110036913
2-[[N'-[(1-cyclopentylpyrazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110036913) has the molecular formula C19H34N6O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-[[N'-[(1-cyclopentylpyrazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[(1-cyclopentylpyrazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110036913 |
| Molecular Formula | C19H34N6O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 2-[[N'-[(1-cyclopentylpyrazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCOCCCN/C(=N\Cc1ccn(C2CCCC2)n1)NCC(=O)N(C)C |
| InChI | InChI=1S/C19H34N6O2/c1-4-27-13-7-11-20-19(22-15-18(26)24(2)3)21-14-16-10-12-25(23-16)17-8-5-6-9-17/h10,12,17H,4-9,11,13-15H2,1-3H3,(H2,20,21,22) |
| InChIKey | DUKFPWXLOMNJHS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|