C18H27N5O3S — CID 110034255
N,N-dimethyl-2-[[N-(2-methylsulfanylethyl)-N'-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]carbamimidoyl]amino]acetamide (PubChem CID 110034255) has the molecular formula C18H27N5O3S and a molecular weight of 393.51 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-(2-methylsulfanylethyl)-N'-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N-(2-methylsulfanylethyl)-N'-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 110034255 |
| Molecular Formula | C18H27N5O3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N,N-dimethyl-2-[[N-(2-methylsulfanylethyl)-N'-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]carbamimidoyl]amino]acetamide |
| SMILES | CSCCN/C(=N\Cc1ccc(N2CCOC2=O)cc1)NCC(=O)N(C)C |
| InChI | InChI=1S/C18H27N5O3S/c1-22(2)16(24)13-21-17(19-8-11-27-3)20-12-14-4-6-15(7-5-14)23-9-10-26-18(23)25/h4-7H,8-13H2,1-3H3,(H2,19,20,21) |
| InChIKey | JTYIZHKBEMOYHO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|