C17H25N5O3 — CID 110035731
2-[[N-ethyl-N'-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110035731) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-ethyl-N'-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110035731 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-[[N-ethyl-N'-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCOC2=O)cc1)NCC(=O)N(C)C |
| InChI | InChI=1S/C17H25N5O3/c1-4-18-16(20-12-15(23)21(2)3)19-11-13-5-7-14(8-6-13)22-9-10-25-17(22)24/h5-8H,4,9-12H2,1-3H3,(H2,18,19,20) |
| InChIKey | WLLBRTXVPZEHLI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|