C21H36IN5O — CID 111365000
2-[[N'-[[4-[cyclohexyl(methyl)amino]phenyl]methyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111365000) has the molecular formula C21H36IN5O and a molecular weight of 501.46 g/mol. Its IUPAC name is 2-[[N'-[[4-[cyclohexyl(methyl)amino]phenyl]methyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[[4-[cyclohexyl(methyl)amino]phenyl]methyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111365000 |
| Molecular Formula | C21H36IN5O |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 2-[[N'-[[4-[cyclohexyl(methyl)amino]phenyl]methyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N(C)C2CCCCC2)cc1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C21H35N5O.HI/c1-5-22-21(24-16-20(27)25(2)3)23-15-17-11-13-19(14-12-17)26(4)18-9-7-6-8-10-18;/h11-14,18H,5-10,15-16H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | DPSNAMBHTOPNPX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|