C17H28BrIN4OS — CID 111977607
2-[[N'-[(4-bromophenyl)methyl]-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111977607) has the molecular formula C17H28BrIN4OS and a molecular weight of 543.31 g/mol. Its IUPAC name is 2-[[N'-[(4-bromophenyl)methyl]-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[(4-bromophenyl)methyl]-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111977607 |
| Molecular Formula | C17H28BrIN4OS |
| Molecular Weight | 543.31 g/mol |
| Exact Mass | 542.02 |
| IUPAC Name | 2-[[N'-[(4-bromophenyl)methyl]-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CSCCCCN/C(=N\Cc1ccc(Br)cc1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C17H27BrN4OS.HI/c1-22(2)16(23)13-21-17(19-10-4-5-11-24-3)20-12-14-6-8-15(18)9-7-14;/h6-9H,4-5,10-13H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | AAFONFLTICUTSQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|