C18H24FN7S — CID 111345563
1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine (PubChem CID 111345563) has the molecular formula C18H24FN7S and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111345563 |
| Molecular Formula | C18H24FN7S |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine |
| SMILES | C/N=C(/NCCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)NCCSC |
| InChI | InChI=1S/C18H24FN7S/c1-22-18(24-10-11-27-2)23-9-3-4-16-15(12-20)17(21)26(25-16)14-7-5-13(19)6-8-14/h5-8H,3-4,9-11,21H2,1-2H3,(H2,22,23,24) |
| InChIKey | UTDNUEYZOJHSPB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|