C19H26FN7S — CID 111344531
2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine (PubChem CID 111344531) has the molecular formula C19H26FN7S and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111344531 |
| Molecular Formula | C19H26FN7S |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine |
| SMILES | CCN/C(=N\CCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)NCCSC |
| InChI | InChI=1S/C19H26FN7S/c1-3-23-19(25-11-12-28-2)24-10-4-5-17-16(13-21)18(22)27(26-17)15-8-6-14(20)7-9-15/h6-9H,3-5,10-12,22H2,1-2H3,(H2,23,24,25) |
| InChIKey | RCZHDOIGNGFSBJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|