C23H35FIN7O — CID 111239560
2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3-butoxypropyl)-3-ethylguanidine;hydroiodide (PubChem CID 111239560) has the molecular formula C23H35FIN7O and a molecular weight of 571.48 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3-butoxypropyl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3-butoxypropyl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111239560 |
| Molecular Formula | C23H35FIN7O |
| Molecular Weight | 571.48 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3-butoxypropyl)-3-ethylguanidine;hydroiodide |
| SMILES | CCCCOCCCN/C(=N/CCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)NCC.I |
| InChI | InChI=1S/C23H34FN7O.HI/c1-3-5-15-32-16-7-14-29-23(27-4-2)28-13-6-8-21-20(17-25)22(26)31(30-21)19-11-9-18(24)10-12-19;/h9-12H,3-8,13-16,26H2,1-2H3,(H2,27,28,29);1H |
| InChIKey | ZRJZPRSPXGWAMZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|