C18H24FN7 — CID 111823419
2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-butylguanidine (PubChem CID 111823419) has the molecular formula C18H24FN7 and a molecular weight of 357.44 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-butylguanidine.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-butylguanidine |
|---|---|
| PubChem CID | 111823419 |
| Molecular Formula | C18H24FN7 |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-butylguanidine |
| SMILES | CCCCN/C(N)=N/CCCc1nn(-c2ccc(F)cc2)c(N)c1C#N |
| InChI | InChI=1S/C18H24FN7/c1-2-3-10-23-18(22)24-11-4-5-16-15(12-20)17(21)26(25-16)14-8-6-13(19)7-9-14/h6-9H,2-5,10-11,21H2,1H3,(H3,22,23,24) |
| InChIKey | VZBMPAUGWYQNLB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|