C23H26FN7 — CID 111823371
2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3-propan-2-ylphenyl)guanidine (PubChem CID 111823371) has the molecular formula C23H26FN7 and a molecular weight of 419.51 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3-propan-2-ylphenyl)guanidine.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3-propan-2-ylphenyl)guanidine |
|---|---|
| PubChem CID | 111823371 |
| Molecular Formula | C23H26FN7 |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3-propan-2-ylphenyl)guanidine |
| SMILES | CC(C)c1cccc(N/C(N)=N/CCCc2nn(-c3ccc(F)cc3)c(N)c2C#N)c1 |
| InChI | InChI=1S/C23H26FN7/c1-15(2)16-5-3-6-18(13-16)29-23(27)28-12-4-7-21-20(14-25)22(26)31(30-21)19-10-8-17(24)9-11-19/h3,5-6,8-11,13,15H,4,7,12,26H2,1-2H3,(H3,27,28,29) |
| InChIKey | CSIQNZSQGKPWLK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|