C25H29N7 — CID 111823431
2-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine (PubChem CID 111823431) has the molecular formula C25H29N7 and a molecular weight of 427.56 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
|---|---|
| PubChem CID | 111823431 |
| Molecular Formula | C25H29N7 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
| SMILES | Cc1ccc(-n2nc(CCC/N=C(\N)Nc3cccc4c3CCCC4)c(C#N)c2N)cc1 |
| InChI | InChI=1S/C25H29N7/c1-17-11-13-19(14-12-17)32-24(27)21(16-26)23(31-32)10-5-15-29-25(28)30-22-9-4-7-18-6-2-3-8-20(18)22/h4,7,9,11-14H,2-3,5-6,8,10,15,27H2,1H3,(H3,28,29,30) |
| InChIKey | PSMNBDZYHUJPFD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|