C24H29N7O2 — CID 111823469
1-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine (PubChem CID 111823469) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111823469 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 1-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine |
| SMILES | COc1ccc(C/N=C(\N)NCCCc2nn(-c3ccc(C)cc3)c(N)c2C#N)cc1OC |
| InChI | InChI=1S/C24H29N7O2/c1-16-6-9-18(10-7-16)31-23(26)19(14-25)20(30-31)5-4-12-28-24(27)29-15-17-8-11-21(32-2)22(13-17)33-3/h6-11,13H,4-5,12,15,26H2,1-3H3,(H3,27,28,29) |
| InChIKey | VUJCRVJNQXOHCS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 136.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|