C21H21N5O2 — CID 38784665
N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methoxybenzamide (PubChem CID 38784665) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methoxybenzamide.
| Compound Name | N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 38784665 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCCCc1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C21H21N5O2/c1-28-19-12-6-5-10-16(19)21(27)24-13-7-11-18-17(14-22)20(23)26(25-18)15-8-3-2-4-9-15/h2-6,8-10,12H,7,11,13,23H2,1H3,(H,24,27) |
| InChIKey | BZNXCRYLQWKVCC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|