C23H24N6O6 — CID 55578067
N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 55578067) has the molecular formula C23H24N6O6 and a molecular weight of 480.48 g/mol. Its IUPAC name is N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55578067 |
| Molecular Formula | C23H24N6O6 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCCCc2nn(-c3ccccc3)c(N)c2C#N)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C23H24N6O6/c1-33-18-12-15(19(29(31)32)21(35-3)20(18)34-2)23(30)26-11-7-10-17-16(13-24)22(25)28(27-17)14-8-5-4-6-9-14/h4-6,8-9,12H,7,10-11,25H2,1-3H3,(H,26,30) |
| InChIKey | BRSPLWJOIYXDPJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 167.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|