C20H18N6O3 — CID 38784646
N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-nitrobenzamide (PubChem CID 38784646) has the molecular formula C20H18N6O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-nitrobenzamide.
| Compound Name | N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 38784646 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-nitrobenzamide |
| SMILES | N#Cc1c(CCCNC(=O)c2cccc([N+](=O)[O-])c2)nn(-c2ccccc2)c1N |
| InChI | InChI=1S/C20H18N6O3/c21-13-17-18(24-25(19(17)22)15-7-2-1-3-8-15)10-5-11-23-20(27)14-6-4-9-16(12-14)26(28)29/h1-4,6-9,12H,5,10-11,22H2,(H,23,27) |
| InChIKey | GWNFJFJLAFYCKI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|