C21H18FN7OS — CID 78903484
N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 78903484) has the molecular formula C21H18FN7OS and a molecular weight of 435.49 g/mol. Its IUPAC name is N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78903484 |
| Molecular Formula | C21H18FN7OS |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | N#Cc1c(CCCNC(=O)c2cc(F)cc3[nH]c(=S)[nH]c23)nn(-c2ccccc2)c1N |
| InChI | InChI=1S/C21H18FN7OS/c22-12-9-14(18-17(10-12)26-21(31)27-18)20(30)25-8-4-7-16-15(11-23)19(24)29(28-16)13-5-2-1-3-6-13/h1-3,5-6,9-10H,4,7-8,24H2,(H,25,30)(H2,26,27,31) |
| InChIKey | PMBJXOLPFLBPNQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|