C17H19FN6O3 — CID 122019327
3-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propylcarbamoylamino]propanoic acid (PubChem CID 122019327) has the molecular formula C17H19FN6O3 and a molecular weight of 374.38 g/mol. Its IUPAC name is 3-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propylcarbamoylamino]propanoic acid.
| Compound Name | 3-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122019327 |
| Molecular Formula | C17H19FN6O3 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propylcarbamoylamino]propanoic acid |
| SMILES | N#Cc1c(CCCNC(=O)NCCC(=O)O)nn(-c2ccc(F)cc2)c1N |
| InChI | InChI=1S/C17H19FN6O3/c18-11-3-5-12(6-4-11)24-16(20)13(10-19)14(23-24)2-1-8-21-17(27)22-9-7-15(25)26/h3-6H,1-2,7-9,20H2,(H,25,26)(H2,21,22,27) |
| InChIKey | FBOOEPPUAXEFNC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 146.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|